C26H33NO4 — CID 15685619
(3R,4R)-5-[(E)-hept-4-enyl]-5-hydroxy-1-methyl-3,4-bis(phenylmethoxy)pyrrolidin-2-one (PubChem CID 15685619) has the molecular formula C26H33NO4 and a molecular weight of 423.55 g/mol. Its IUPAC name is (3R,4R)-5-[(E)-hept-4-enyl]-5-hydroxy-1-methyl-3,4-bis(phenylmethoxy)pyrrolidin-2-one.
| Compound Name | (3R,4R)-5-[(E)-hept-4-enyl]-5-hydroxy-1-methyl-3,4-bis(phenylmethoxy)pyrrolidin-2-one |
|---|---|
| PubChem CID | 15685619 |
| Molecular Formula | C26H33NO4 |
| Molecular Weight | 423.55 g/mol |
| Exact Mass | 423.24 |
| IUPAC Name | (3R,4R)-5-[(E)-hept-4-enyl]-5-hydroxy-1-methyl-3,4-bis(phenylmethoxy)pyrrolidin-2-one |
| SMILES | CC/C=C/CCCC1(O)[C@H](OCc2ccccc2)[C@@H](OCc2ccccc2)C(=O)N1C |
| InChI | InChI=1S/C26H33NO4/c1-3-4-5-6-13-18-26(29)24(31-20-22-16-11-8-12-17-22)23(25(28)27(26)2)30-19-21-14-9-7-10-15-21/h4-5,7-12,14-17,23-24,29H,3,6,13,18-20H2,1-2H3/b5-4+/t23-,24-,26?/m1/s1 |
| InChIKey | MXEJYNWOMUYPGW-CQTYZFBZSA-N |
| XLogP | 4.45 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.55 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|