C15H19NO2 — CID 53343701
(1R,4R)-4-ethenyl-11-methyl-5-azatricyclo[8.3.0.01,5]tridec-10-ene-6,12-dione (PubChem CID 53343701) has the molecular formula C15H19NO2 and a molecular weight of 245.32 g/mol. Its IUPAC name is (1R,4R)-4-ethenyl-11-methyl-5-azatricyclo[8.3.0.01,5]tridec-10-ene-6,12-dione.
| Compound Name | (1R,4R)-4-ethenyl-11-methyl-5-azatricyclo[8.3.0.01,5]tridec-10-ene-6,12-dione |
|---|---|
| PubChem CID | 53343701 |
| Molecular Formula | C15H19NO2 |
| Molecular Weight | 245.32 g/mol |
| Exact Mass | 245.14 |
| IUPAC Name | (1R,4R)-4-ethenyl-11-methyl-5-azatricyclo[8.3.0.01,5]tridec-10-ene-6,12-dione |
| SMILES | C=C[C@H]1CC[C@@]23CC(=O)C(C)=C2CCCC(=O)N13 |
| InChI | InChI=1S/C15H19NO2/c1-3-11-7-8-15-9-13(17)10(2)12(15)5-4-6-14(18)16(11)15/h3,11H,1,4-9H2,2H3/t11-,15+/m0/s1 |
| InChIKey | LYYFPRUYQJTBJE-XHDPSFHLSA-N |
| XLogP | 2.38 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.32 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|