C16H30N+ — CID 53344480
(4S,7R)-1-hexyl-10-methyl-1-azoniatricyclo[5.2.1.04,10]decane (PubChem CID 53344480) has the molecular formula C16H30N+ and a molecular weight of 236.42 g/mol. Its IUPAC name is (4S,7R)-1-hexyl-10-methyl-1-azoniatricyclo[5.2.1.04,10]decane.
| Compound Name | (4S,7R)-1-hexyl-10-methyl-1-azoniatricyclo[5.2.1.04,10]decane |
|---|---|
| PubChem CID | 53344480 |
| Molecular Formula | C16H30N+ |
| Molecular Weight | 236.42 g/mol |
| Exact Mass | 236.24 |
| IUPAC Name | (4S,7R)-1-hexyl-10-methyl-1-azoniatricyclo[5.2.1.04,10]decane |
| SMILES | CCCCCC[N+]12CC[C@H]3CC[C@@H](CC1)C32C |
| InChI | InChI=1S/C16H30N/c1-3-4-5-6-11-17-12-9-14-7-8-15(10-13-17)16(14,17)2/h14-15H,3-13H2,1-2H3/q+1/t14-,15+,16?,17? |
| InChIKey | YNVLJZYADGOOOW-RYTJFDOTSA-N |
| XLogP | 3.98 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.42 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|