C21H32N2O2 — CID 53345814
N-[4-(4-amino-4-oxobutyl)phenyl]-5-methyl-2-propan-2-ylcyclohexane-1-carboxamide (PubChem CID 53345814) has the molecular formula C21H32N2O2 and a molecular weight of 344.50 g/mol. Its IUPAC name is N-[4-(4-amino-4-oxobutyl)phenyl]-5-methyl-2-propan-2-ylcyclohexane-1-carboxamide.
| Compound Name | N-[4-(4-amino-4-oxobutyl)phenyl]-5-methyl-2-propan-2-ylcyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 53345814 |
| Molecular Formula | C21H32N2O2 |
| Molecular Weight | 344.50 g/mol |
| Exact Mass | 344.25 |
| IUPAC Name | N-[4-(4-amino-4-oxobutyl)phenyl]-5-methyl-2-propan-2-ylcyclohexane-1-carboxamide |
| SMILES | CC1CCC(C(C)C)C(C(=O)Nc2ccc(CCCC(N)=O)cc2)C1 |
| InChI | InChI=1S/C21H32N2O2/c1-14(2)18-12-7-15(3)13-19(18)21(25)23-17-10-8-16(9-11-17)5-4-6-20(22)24/h8-11,14-15,18-19H,4-7,12-13H2,1-3H3,(H2,22,24)(H,23,25) |
| InChIKey | WUTNCWWKKBOBKL-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.50 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |