C16H32O3Si — CID 53348555
(2R,4R,5R)-4-[tert-butyl(dimethyl)silyl]oxy-5-pentyloxolane-2-carbaldehyde (PubChem CID 53348555) has the molecular formula C16H32O3Si and a molecular weight of 300.52 g/mol. Its IUPAC name is (2R,4R,5R)-4-[tert-butyl(dimethyl)silyl]oxy-5-pentyloxolane-2-carbaldehyde.
| Compound Name | (2R,4R,5R)-4-[tert-butyl(dimethyl)silyl]oxy-5-pentyloxolane-2-carbaldehyde |
|---|---|
| PubChem CID | 53348555 |
| Molecular Formula | C16H32O3Si |
| Molecular Weight | 300.52 g/mol |
| Exact Mass | 300.21 |
| IUPAC Name | (2R,4R,5R)-4-[tert-butyl(dimethyl)silyl]oxy-5-pentyloxolane-2-carbaldehyde |
| SMILES | CCCCC[C@H]1O[C@@H](C=O)C[C@H]1O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C16H32O3Si/c1-7-8-9-10-14-15(11-13(12-17)18-14)19-20(5,6)16(2,3)4/h12-15H,7-11H2,1-6H3/t13-,14-,15-/m1/s1 |
| InChIKey | KHQDITPXZMHLLJ-RBSFLKMASA-N |
| XLogP | 4.31 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.52 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|