C15H21ClN2O3Pt — CID 53348843
2-[[[(1R,2R)-2-aminocyclohexyl]amino]methyl]phenolate;2-chloroacetate;platinum(2+) (PubChem CID 53348843) has the molecular formula C15H21ClN2O3Pt and a molecular weight of 507.88 g/mol. Its IUPAC name is 2-[[[(1R,2R)-2-aminocyclohexyl]amino]methyl]phenolate;2-chloroacetate;platinum(2+).
| Compound Name | 2-[[[(1R,2R)-2-aminocyclohexyl]amino]methyl]phenolate;2-chloroacetate;platinum(2+) |
|---|---|
| PubChem CID | 53348843 |
| Molecular Formula | C15H21ClN2O3Pt |
| Molecular Weight | 507.88 g/mol |
| Exact Mass | 507.09 |
| IUPAC Name | 2-[[[(1R,2R)-2-aminocyclohexyl]amino]methyl]phenolate;2-chloroacetate;platinum(2+) |
| SMILES | N[C@@H]1CCCC[C@H]1NCc1ccccc1[O-].O=C([O-])CCl.[Pt+2] |
| InChI | InChI=1S/C13H20N2O.C2H3ClO2.Pt/c14-11-6-2-3-7-12(11)15-9-10-5-1-4-8-13(10)16;3-1-2(4)5;/h1,4-5,8,11-12,15-16H,2-3,6-7,9,14H2;1H2,(H,4,5);/q;;+2/p-2/t11-,12-;;/m1../s1 |
| InChIKey | ZPZGOFZCFYTIQM-MBORUXJMSA-L |
| XLogP | 0.09 |
| TPSA | 101.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.88 |
| LogP ≤ 5 | 0.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|