C16H26O3 — CID 53348937
(3S,3aR,6R,6aS)-3-[(1R)-1-hydroxy-4-methyl-3-methylidenepentyl]-3,6-dimethyl-4,5,6,6a-tetrahydro-3aH-cyclopenta[c]furan-1-one (PubChem CID 53348937) has the molecular formula C16H26O3 and a molecular weight of 266.38 g/mol. Its IUPAC name is (3S,3aR,6R,6aS)-3-[(1R)-1-hydroxy-4-methyl-3-methylidenepentyl]-3,6-dimethyl-4,5,6,6a-tetrahydro-3aH-cyclopenta[c]furan-1-one.
| Compound Name | (3S,3aR,6R,6aS)-3-[(1R)-1-hydroxy-4-methyl-3-methylidenepentyl]-3,6-dimethyl-4,5,6,6a-tetrahydro-3aH-cyclopenta[c]furan-1-one |
|---|---|
| PubChem CID | 53348937 |
| Molecular Formula | C16H26O3 |
| Molecular Weight | 266.38 g/mol |
| Exact Mass | 266.19 |
| IUPAC Name | (3S,3aR,6R,6aS)-3-[(1R)-1-hydroxy-4-methyl-3-methylidenepentyl]-3,6-dimethyl-4,5,6,6a-tetrahydro-3aH-cyclopenta[c]furan-1-one |
| SMILES | C=C(C[C@@H](O)[C@@]1(C)OC(=O)[C@H]2[C@H](C)CC[C@H]21)C(C)C |
| InChI | InChI=1S/C16H26O3/c1-9(2)11(4)8-13(17)16(5)12-7-6-10(3)14(12)15(18)19-16/h9-10,12-14,17H,4,6-8H2,1-3,5H3/t10-,12-,13-,14+,16+/m1/s1 |
| InChIKey | KPKTYCRRWFUHNE-UYLCMAPUSA-N |
| XLogP | 2.93 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.38 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|