C12H20O3 — CID 10703760
(3S,4R,5S)-4-ethenyl-5-[(1S)-1-hydroxypentyl]-3-methyloxolan-2-one (PubChem CID 10703760) has the molecular formula C12H20O3 and a molecular weight of 212.29 g/mol. Its IUPAC name is (3S,4R,5S)-4-ethenyl-5-[(1S)-1-hydroxypentyl]-3-methyloxolan-2-one.
| Compound Name | (3S,4R,5S)-4-ethenyl-5-[(1S)-1-hydroxypentyl]-3-methyloxolan-2-one |
|---|---|
| PubChem CID | 10703760 |
| Molecular Formula | C12H20O3 |
| Molecular Weight | 212.29 g/mol |
| Exact Mass | 212.14 |
| IUPAC Name | (3S,4R,5S)-4-ethenyl-5-[(1S)-1-hydroxypentyl]-3-methyloxolan-2-one |
| SMILES | C=C[C@H]1[C@@H]([C@@H](O)CCCC)OC(=O)[C@H]1C |
| InChI | InChI=1S/C12H20O3/c1-4-6-7-10(13)11-9(5-2)8(3)12(14)15-11/h5,8-11,13H,2,4,6-7H2,1,3H3/t8-,9+,10-,11-/m0/s1 |
| InChIKey | BUTKFGJEHAWVNW-VLEAKVRGSA-N |
| XLogP | 1.90 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.29 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|