C11H16O4 — CID 11435791
(E)-4-[(3R,5S)-5-[(1S)-1-hydroxypropyl]-2-oxooxolan-3-yl]but-2-enal (PubChem CID 11435791) has the molecular formula C11H16O4 and a molecular weight of 212.24 g/mol. Its IUPAC name is (E)-4-[(3R,5S)-5-[(1S)-1-hydroxypropyl]-2-oxooxolan-3-yl]but-2-enal.
| Compound Name | (E)-4-[(3R,5S)-5-[(1S)-1-hydroxypropyl]-2-oxooxolan-3-yl]but-2-enal |
|---|---|
| PubChem CID | 11435791 |
| Molecular Formula | C11H16O4 |
| Molecular Weight | 212.24 g/mol |
| Exact Mass | 212.10 |
| IUPAC Name | (E)-4-[(3R,5S)-5-[(1S)-1-hydroxypropyl]-2-oxooxolan-3-yl]but-2-enal |
| SMILES | CC[C@H](O)[C@@H]1C[C@@H](C/C=C/C=O)C(=O)O1 |
| InChI | InChI=1S/C11H16O4/c1-2-9(13)10-7-8(11(14)15-10)5-3-4-6-12/h3-4,6,8-10,13H,2,5,7H2,1H3/b4-3+/t8-,9+,10+/m1/s1 |
| InChIKey | QMFWASKOALFPBQ-GVQKYEPPSA-N |
| XLogP | 0.83 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.24 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|