C23H12Br3F2NS3 — CID 53349975
2,4,5-tris[(2-bromophenyl)sulfanyl]-3,6-difluoropyridine (PubChem CID 53349975) has the molecular formula C23H12Br3F2NS3 and a molecular weight of 676.27 g/mol. Its IUPAC name is 2,4,5-tris[(2-bromophenyl)sulfanyl]-3,6-difluoropyridine.
| Compound Name | 2,4,5-tris[(2-bromophenyl)sulfanyl]-3,6-difluoropyridine |
|---|---|
| PubChem CID | 53349975 |
| Molecular Formula | C23H12Br3F2NS3 |
| Molecular Weight | 676.27 g/mol |
| Exact Mass | 672.77 |
| IUPAC Name | 2,4,5-tris[(2-bromophenyl)sulfanyl]-3,6-difluoropyridine |
| SMILES | Fc1nc(Sc2ccccc2Br)c(F)c(Sc2ccccc2Br)c1Sc1ccccc1Br |
| InChI | InChI=1S/C23H12Br3F2NS3/c24-13-7-1-4-10-16(13)30-20-19(27)23(32-18-12-6-3-9-15(18)26)29-22(28)21(20)31-17-11-5-2-8-14(17)25/h1-12H |
| InChIKey | UZWXHUVCONCGTN-UHFFFAOYSA-N |
| XLogP | 10.10 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 676.27 |
| LogP ≤ 5 | 10.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|