About 2,4,5-tris[(2-bromophenyl)sulfanyl]-3,6-difluoropyridine
2,4,5-tris[(2-bromophenyl)sulfanyl]-3,6-difluoropyridine (PubChem CID 53349975) has the molecular formula C23H12Br3F2NS3
and a molecular weight of 676.27 g/mol. Its IUPAC name is 2,4,5-tris[(2-bromophenyl)sulfanyl]-3,6-difluoropyridine.
Molecular Properties
| Compound Name | 2,4,5-tris[(2-bromophenyl)sulfanyl]-3,6-difluoropyridine |
| PubChem CID | 53349975 |
| Molecular Formula | C23H12Br3F2NS3 |
| Molecular Weight | 676.27 g/mol |
| Exact Mass | 672.77 |
| IUPAC Name | 2,4,5-tris[(2-bromophenyl)sulfanyl]-3,6-difluoropyridine |
| SMILES | Fc1nc(Sc2ccccc2Br)c(F)c(Sc2ccccc2Br)c1Sc1ccccc1Br |
| InChI | InChI=1S/C23H12Br3F2NS3/c24-13-7-1-4-10-16(13)30-20-19(27)23(32-18-12-6-3-9-15(18)26)29-22(28)21(20)31-17-11-5-2-8-14(17)25/h1-12H |
| InChIKey | UZWXHUVCONCGTN-UHFFFAOYSA-N |
| XLogP | 10.10 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 676.27 |
| LogP ≤ 5 | 10.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|
Analyze 2,4,5-tris[(2-bromophenyl)sulfanyl]-3,6-difluoropyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,4,5-tris[(2-bromophenyl)sulfanyl]-3,6-difluoropyridine?
The IUPAC name of 2,4,5-tris[(2-bromophenyl)sulfanyl]-3,6-difluoropyridine (CID 53349975) is 2,4,5-tris[(2-bromophenyl)sulfanyl]-3,6-difluoropyridine.
What is the SMILES notation for 2,4,5-tris[(2-bromophenyl)sulfanyl]-3,6-difluoropyridine?
The canonical SMILES for 2,4,5-tris[(2-bromophenyl)sulfanyl]-3,6-difluoropyridine is Fc1nc(Sc2ccccc2Br)c(F)c(Sc2ccccc2Br)c1Sc1ccccc1Br.
What is the InChIKey of 2,4,5-tris[(2-bromophenyl)sulfanyl]-3,6-difluoropyridine?
The InChIKey is UZWXHUVCONCGTN-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H12Br3F2NS3/c24-13-7-1-4-10-16(13)30-20-19(27)23(32-18-12-6-3-9-15(18)26)29-22(28)21(20)31-17-11-5-2-8-14(17)25/h1-12H.
What are the key properties of 2,4,5-tris[(2-bromophenyl)sulfanyl]-3,6-difluoropyridine?
2,4,5-tris[(2-bromophenyl)sulfanyl]-3,6-difluoropyridine has a molecular weight of 676.27 g/mol, XLogP of 10.10, 6 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2,4,5-tris[(2-bromophenyl)sulfanyl]-3,6-difluoropyridine is sourced from PubChem (CID 53349975), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).