C19H24ClN2O- — CID 53350754
6-methoxy-1-(4-methylcyclohex-3-en-1-yl)-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indole chloride (PubChem CID 53350754) has the molecular formula C19H24ClN2O- and a molecular weight of 331.87 g/mol. Its IUPAC name is 6-methoxy-1-(4-methylcyclohex-3-en-1-yl)-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indole chloride.
| Compound Name | 6-methoxy-1-(4-methylcyclohex-3-en-1-yl)-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indole chloride |
|---|---|
| PubChem CID | 53350754 |
| Molecular Formula | C19H24ClN2O- |
| Molecular Weight | 331.87 g/mol |
| Exact Mass | 331.16 |
| IUPAC Name | 6-methoxy-1-(4-methylcyclohex-3-en-1-yl)-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indole chloride |
| SMILES | COc1ccc2[nH]c3c(c2c1)CCNC3C1CC=C(C)CC1.[Cl-] |
| InChI | InChI=1S/C19H24N2O.ClH/c1-12-3-5-13(6-4-12)18-19-15(9-10-20-18)16-11-14(22-2)7-8-17(16)21-19;/h3,7-8,11,13,18,20-21H,4-6,9-10H2,1-2H3;1H/p-1 |
| InChIKey | LHCQQHIUVDSFTA-UHFFFAOYSA-M |
| XLogP | 1.11 |
| TPSA | 37.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.87 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|