C21H28N2O — CID 904685
(1S)-6-methoxy-1-[(1R,6S)-3,4,6-trimethylcyclohex-3-en-1-yl]-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indole (PubChem CID 904685) has the molecular formula C21H28N2O and a molecular weight of 324.47 g/mol. Its IUPAC name is (1S)-6-methoxy-1-[(1R,6S)-3,4,6-trimethylcyclohex-3-en-1-yl]-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indole.
| Compound Name | (1S)-6-methoxy-1-[(1R,6S)-3,4,6-trimethylcyclohex-3-en-1-yl]-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indole |
|---|---|
| PubChem CID | 904685 |
| Molecular Formula | C21H28N2O |
| Molecular Weight | 324.47 g/mol |
| Exact Mass | 324.22 |
| IUPAC Name | (1S)-6-methoxy-1-[(1R,6S)-3,4,6-trimethylcyclohex-3-en-1-yl]-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indole |
| SMILES | COc1ccc2[nH]c3c(c2c1)CCN[C@H]3[C@@H]1CC(C)=C(C)C[C@@H]1C |
| InChI | InChI=1S/C21H28N2O/c1-12-9-14(3)17(10-13(12)2)20-21-16(7-8-22-20)18-11-15(24-4)5-6-19(18)23-21/h5-6,11,14,17,20,22-23H,7-10H2,1-4H3/t14-,17+,20-/m0/s1 |
| InChIKey | NNRHSNHZPUZQPQ-NQYLQCIDSA-N |
| XLogP | 4.75 |
| TPSA | 37.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.47 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|