C8H14N2O2 — CID 533526
4-piperidin-1-yl-1,3-oxazolidin-2-one (PubChem CID 533526) has the molecular formula C8H14N2O2 and a molecular weight of 170.21 g/mol. Its IUPAC name is 4-piperidin-1-yl-1,3-oxazolidin-2-one.
| Compound Name | 4-piperidin-1-yl-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 533526 |
| Molecular Formula | C8H14N2O2 |
| Molecular Weight | 170.21 g/mol |
| Exact Mass | 170.11 |
| IUPAC Name | 4-piperidin-1-yl-1,3-oxazolidin-2-one |
| SMILES | O=C1NC(N2CCCCC2)CO1 |
| InChI | InChI=1S/C8H14N2O2/c11-8-9-7(6-12-8)10-4-2-1-3-5-10/h7H,1-6H2,(H,9,11) |
| InChIKey | OVEFELZINYPKKG-UHFFFAOYSA-N |
| XLogP | 0.54 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 170.21 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |