C18H17BrF2O2 — CID 53354861
ethyl 2-[(4-bromophenyl)-difluoromethyl]-4,5-dimethylbenzoate (PubChem CID 53354861) has the molecular formula C18H17BrF2O2 and a molecular weight of 383.23 g/mol. Its IUPAC name is ethyl 2-[(4-bromophenyl)-difluoromethyl]-4,5-dimethylbenzoate.
| Compound Name | ethyl 2-[(4-bromophenyl)-difluoromethyl]-4,5-dimethylbenzoate |
|---|---|
| PubChem CID | 53354861 |
| Molecular Formula | C18H17BrF2O2 |
| Molecular Weight | 383.23 g/mol |
| Exact Mass | 382.04 |
| IUPAC Name | ethyl 2-[(4-bromophenyl)-difluoromethyl]-4,5-dimethylbenzoate |
| SMILES | CCOC(=O)c1cc(C)c(C)cc1C(F)(F)c1ccc(Br)cc1 |
| InChI | InChI=1S/C18H17BrF2O2/c1-4-23-17(22)15-9-11(2)12(3)10-16(15)18(20,21)13-5-7-14(19)8-6-13/h5-10H,4H2,1-3H3 |
| InChIKey | SHUUIMKYTXZJAH-UHFFFAOYSA-N |
| XLogP | 5.38 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.23 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |