C15H22O3 — CID 53355319
trans-(2S,3S)-2-[2-[(E)-but-2-enyl]-1,3-dioxolan-2-yl]-3-prop-2-enylcyclopentan-1-one (PubChem CID 53355319) has the molecular formula C15H22O3 and a molecular weight of 250.34 g/mol. Its IUPAC name is trans-(2S,3S)-2-[2-[(E)-but-2-enyl]-1,3-dioxolan-2-yl]-3-prop-2-enylcyclopentan-1-one.
| Compound Name | trans-(2S,3S)-2-[2-[(E)-but-2-enyl]-1,3-dioxolan-2-yl]-3-prop-2-enylcyclopentan-1-one |
|---|---|
| PubChem CID | 53355319 |
| Molecular Formula | C15H22O3 |
| Molecular Weight | 250.34 g/mol |
| Exact Mass | 250.16 |
| IUPAC Name | trans-(2S,3S)-2-[2-[(E)-but-2-enyl]-1,3-dioxolan-2-yl]-3-prop-2-enylcyclopentan-1-one |
| SMILES | C=CC[C@@H]1CCC(=O)[C@H]1C1(C/C=C/C)OCCO1 |
| InChI | InChI=1S/C15H22O3/c1-3-5-9-15(17-10-11-18-15)14-12(6-4-2)7-8-13(14)16/h3-5,12,14H,2,6-11H2,1H3/b5-3+/t12-,14+/m1/s1 |
| InChIKey | WWUWZWCARJYCDN-ZPSXMKBBSA-N |
| XLogP | 2.87 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.34 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|