C26H44O5 — CID 59963469
methyl (Z)-7-[(2S)-2-[2-(2-heptyl-1,3-dioxolan-2-yl)ethyl]-3-methyl-5-oxocyclopentyl]hept-5-enoate (PubChem CID 59963469) has the molecular formula C26H44O5 and a molecular weight of 436.63 g/mol. Its IUPAC name is methyl (Z)-7-[(2S)-2-[2-(2-heptyl-1,3-dioxolan-2-yl)ethyl]-3-methyl-5-oxocyclopentyl]hept-5-enoate.
| Compound Name | methyl (Z)-7-[(2S)-2-[2-(2-heptyl-1,3-dioxolan-2-yl)ethyl]-3-methyl-5-oxocyclopentyl]hept-5-enoate |
|---|---|
| PubChem CID | 59963469 |
| Molecular Formula | C26H44O5 |
| Molecular Weight | 436.63 g/mol |
| Exact Mass | 436.32 |
| IUPAC Name | methyl (Z)-7-[(2S)-2-[2-(2-heptyl-1,3-dioxolan-2-yl)ethyl]-3-methyl-5-oxocyclopentyl]hept-5-enoate |
| SMILES | CCCCCCCC1(CC[C@H]2C(C)CC(=O)C2C/C=C\CCCC(=O)OC)OCCO1 |
| InChI | InChI=1S/C26H44O5/c1-4-5-6-9-12-16-26(30-18-19-31-26)17-15-22-21(2)20-24(27)23(22)13-10-7-8-11-14-25(28)29-3/h7,10,21-23H,4-6,8-9,11-20H2,1-3H3/b10-7-/t21?,22-,23?/m0/s1 |
| InChIKey | VREPIJDKIKHGDA-IURVRNNYSA-N |
| XLogP | 6.00 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.63 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|