C18H19IN2O2 — CID 5335636
N-[(E)-(4-tert-butylphenyl)methylideneamino]-2-hydroxy-5-iodobenzamide (PubChem CID 5335636) has the molecular formula C18H19IN2O2 and a molecular weight of 422.27 g/mol. Its IUPAC name is N-[(E)-(4-tert-butylphenyl)methylideneamino]-2-hydroxy-5-iodobenzamide.
| Compound Name | N-[(E)-(4-tert-butylphenyl)methylideneamino]-2-hydroxy-5-iodobenzamide |
|---|---|
| PubChem CID | 5335636 |
| Molecular Formula | C18H19IN2O2 |
| Molecular Weight | 422.27 g/mol |
| Exact Mass | 422.05 |
| IUPAC Name | N-[(E)-(4-tert-butylphenyl)methylideneamino]-2-hydroxy-5-iodobenzamide |
| SMILES | CC(C)(C)c1ccc(/C=N/NC(=O)c2cc(I)ccc2O)cc1 |
| InChI | InChI=1S/C18H19IN2O2/c1-18(2,3)13-6-4-12(5-7-13)11-20-21-17(23)15-10-14(19)8-9-16(15)22/h4-11,22H,1-3H3,(H,21,23)/b20-11+ |
| InChIKey | JSQHKBDZAZUTRP-RGVLZGJSSA-N |
| XLogP | 4.06 |
| TPSA | 61.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.27 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|