C14H12ClN3O2 — CID 5410349
5-amino-N-[(Z)-(4-chlorophenyl)methylideneamino]-2-hydroxybenzamide (PubChem CID 5410349) has the molecular formula C14H12ClN3O2 and a molecular weight of 289.72 g/mol. Its IUPAC name is 5-amino-N-[(Z)-(4-chlorophenyl)methylideneamino]-2-hydroxybenzamide.
| Compound Name | 5-amino-N-[(Z)-(4-chlorophenyl)methylideneamino]-2-hydroxybenzamide |
|---|---|
| PubChem CID | 5410349 |
| Molecular Formula | C14H12ClN3O2 |
| Molecular Weight | 289.72 g/mol |
| Exact Mass | 289.06 |
| IUPAC Name | 5-amino-N-[(Z)-(4-chlorophenyl)methylideneamino]-2-hydroxybenzamide |
| SMILES | Nc1ccc(O)c(C(=O)N/N=C\c2ccc(Cl)cc2)c1 |
| InChI | InChI=1S/C14H12ClN3O2/c15-10-3-1-9(2-4-10)8-17-18-14(20)12-7-11(16)5-6-13(12)19/h1-8,19H,16H2,(H,18,20)/b17-8- |
| InChIKey | FPFVYRGZHDPIDT-IUXPMGMMSA-N |
| XLogP | 2.39 |
| TPSA | 87.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.72 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|