C22H19N3O4 — CID 53358085
2-morpholin-4-yl-9-(pyridin-3-ylmethoxy)benzo[g][1,3]benzoxazin-4-one (PubChem CID 53358085) has the molecular formula C22H19N3O4 and a molecular weight of 389.41 g/mol. Its IUPAC name is 2-morpholin-4-yl-9-(pyridin-3-ylmethoxy)benzo[g][1,3]benzoxazin-4-one.
| Compound Name | 2-morpholin-4-yl-9-(pyridin-3-ylmethoxy)benzo[g][1,3]benzoxazin-4-one |
|---|---|
| PubChem CID | 53358085 |
| Molecular Formula | C22H19N3O4 |
| Molecular Weight | 389.41 g/mol |
| Exact Mass | 389.14 |
| IUPAC Name | 2-morpholin-4-yl-9-(pyridin-3-ylmethoxy)benzo[g][1,3]benzoxazin-4-one |
| SMILES | O=c1nc(N2CCOCC2)oc2cc3c(OCc4cccnc4)cccc3cc12 |
| InChI | InChI=1S/C22H19N3O4/c26-21-18-11-16-4-1-5-19(28-14-15-3-2-6-23-13-15)17(16)12-20(18)29-22(24-21)25-7-9-27-10-8-25/h1-6,11-13H,7-10,14H2 |
| InChIKey | VUPOSOFDZXONOZ-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 77.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.41 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|