C30H29FN2O3 — CID 59614449
1-(3-fluoro-5-morpholin-4-ylphenyl)-2-[4-(3-pyridin-3-ylpropoxy)naphthalen-1-yl]ethanone (PubChem CID 59614449) has the molecular formula C30H29FN2O3 and a molecular weight of 484.57 g/mol. Its IUPAC name is 1-(3-fluoro-5-morpholin-4-ylphenyl)-2-[4-(3-pyridin-3-ylpropoxy)naphthalen-1-yl]ethanone.
| Compound Name | 1-(3-fluoro-5-morpholin-4-ylphenyl)-2-[4-(3-pyridin-3-ylpropoxy)naphthalen-1-yl]ethanone |
|---|---|
| PubChem CID | 59614449 |
| Molecular Formula | C30H29FN2O3 |
| Molecular Weight | 484.57 g/mol |
| Exact Mass | 484.22 |
| IUPAC Name | 1-(3-fluoro-5-morpholin-4-ylphenyl)-2-[4-(3-pyridin-3-ylpropoxy)naphthalen-1-yl]ethanone |
| SMILES | O=C(Cc1ccc(OCCCc2cccnc2)c2ccccc12)c1cc(F)cc(N2CCOCC2)c1 |
| InChI | InChI=1S/C30H29FN2O3/c31-25-17-24(18-26(20-25)33-12-15-35-16-13-33)29(34)19-23-9-10-30(28-8-2-1-7-27(23)28)36-14-4-6-22-5-3-11-32-21-22/h1-3,5,7-11,17-18,20-21H,4,6,12-16,19H2 |
| InChIKey | NCJYLSXFXHBGTI-UHFFFAOYSA-N |
| XLogP | 5.65 |
| TPSA | 51.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.57 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|