C26H29FN2O — CID 53359333
(2R)-3,3-bis[4-(dimethylamino)phenyl]-2-[(2-fluorophenyl)methyl]propanal (PubChem CID 53359333) has the molecular formula C26H29FN2O and a molecular weight of 404.53 g/mol. Its IUPAC name is (2R)-3,3-bis[4-(dimethylamino)phenyl]-2-[(2-fluorophenyl)methyl]propanal.
| Compound Name | (2R)-3,3-bis[4-(dimethylamino)phenyl]-2-[(2-fluorophenyl)methyl]propanal |
|---|---|
| PubChem CID | 53359333 |
| Molecular Formula | C26H29FN2O |
| Molecular Weight | 404.53 g/mol |
| Exact Mass | 404.23 |
| IUPAC Name | (2R)-3,3-bis[4-(dimethylamino)phenyl]-2-[(2-fluorophenyl)methyl]propanal |
| SMILES | CN(C)c1ccc(C(c2ccc(N(C)C)cc2)[C@H](C=O)Cc2ccccc2F)cc1 |
| InChI | InChI=1S/C26H29FN2O/c1-28(2)23-13-9-19(10-14-23)26(20-11-15-24(16-12-20)29(3)4)22(18-30)17-21-7-5-6-8-25(21)27/h5-16,18,22,26H,17H2,1-4H3/t22-/m0/s1 |
| InChIKey | YHAPMQTUNXVDJH-QFIPXVFZSA-N |
| XLogP | 5.15 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.53 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_F(14)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|