C29H35NO — CID 135024924
(2R)-2-[(R)-[4-(dimethylamino)phenyl]-(4-phenylphenyl)methyl]octanal (PubChem CID 135024924) has the molecular formula C29H35NO and a molecular weight of 413.61 g/mol. Its IUPAC name is (2R)-2-[(R)-[4-(dimethylamino)phenyl]-(4-phenylphenyl)methyl]octanal.
| Compound Name | (2R)-2-[(R)-[4-(dimethylamino)phenyl]-(4-phenylphenyl)methyl]octanal |
|---|---|
| PubChem CID | 135024924 |
| Molecular Formula | C29H35NO |
| Molecular Weight | 413.61 g/mol |
| Exact Mass | 413.27 |
| IUPAC Name | (2R)-2-[(R)-[4-(dimethylamino)phenyl]-(4-phenylphenyl)methyl]octanal |
| SMILES | CCCCCC[C@@H](C=O)[C@H](c1ccc(-c2ccccc2)cc1)c1ccc(N(C)C)cc1 |
| InChI | InChI=1S/C29H35NO/c1-4-5-6-8-13-27(22-31)29(26-18-20-28(21-19-26)30(2)3)25-16-14-24(15-17-25)23-11-9-7-10-12-23/h7,9-12,14-22,27,29H,4-6,8,13H2,1-3H3/t27-,29+/m0/s1 |
| InChIKey | JESNZOCKJAMDSF-LMSSTIIKSA-N |
| XLogP | 7.34 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.61 |
| LogP ≤ 5 | 7.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|