C26H40N2O3 — CID 135024877
tert-butyl N-[(4S,5R)-4-[4-(dimethylamino)phenyl]-5-formylundec-2-ynyl]-N-methylcarbamate (PubChem CID 135024877) has the molecular formula C26H40N2O3 and a molecular weight of 428.62 g/mol. Its IUPAC name is tert-butyl N-[(4S,5R)-4-[4-(dimethylamino)phenyl]-5-formylundec-2-ynyl]-N-methylcarbamate.
| Compound Name | tert-butyl N-[(4S,5R)-4-[4-(dimethylamino)phenyl]-5-formylundec-2-ynyl]-N-methylcarbamate |
|---|---|
| PubChem CID | 135024877 |
| Molecular Formula | C26H40N2O3 |
| Molecular Weight | 428.62 g/mol |
| Exact Mass | 428.30 |
| IUPAC Name | tert-butyl N-[(4S,5R)-4-[4-(dimethylamino)phenyl]-5-formylundec-2-ynyl]-N-methylcarbamate |
| SMILES | CCCCCC[C@@H](C=O)[C@H](C#CCN(C)C(=O)OC(C)(C)C)c1ccc(N(C)C)cc1 |
| InChI | InChI=1S/C26H40N2O3/c1-8-9-10-11-13-22(20-29)24(21-15-17-23(18-16-21)27(5)6)14-12-19-28(7)25(30)31-26(2,3)4/h15-18,20,22,24H,8-11,13,19H2,1-7H3/t22-,24+/m0/s1 |
| InChIKey | ZVNIBLKERPDVJC-LADGPHEKSA-N |
| XLogP | 5.49 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.62 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|