C25H38O4 — CID 53359839
(1R,3S,7R,8E,11S,12R)-12-[(Z,2S)-5,6-dihydroxy-6-methylhept-3-en-2-yl]-8-(hydroxymethyl)-1,4-dimethyltricyclo[9.3.0.03,7]tetradeca-4,8-dien-6-one (PubChem CID 53359839) has the molecular formula C25H38O4 and a molecular weight of 402.58 g/mol. Its IUPAC name is (1R,3S,7R,8E,11S,12R)-12-[(Z,2S)-5,6-dihydroxy-6-methylhept-3-en-2-yl]-8-(hydroxymethyl)-1,4-dimethyltricyclo[9.3.0.03,7]tetradeca-4,8-dien-6-one.
| Compound Name | (1R,3S,7R,8E,11S,12R)-12-[(Z,2S)-5,6-dihydroxy-6-methylhept-3-en-2-yl]-8-(hydroxymethyl)-1,4-dimethyltricyclo[9.3.0.03,7]tetradeca-4,8-dien-6-one |
|---|---|
| PubChem CID | 53359839 |
| Molecular Formula | C25H38O4 |
| Molecular Weight | 402.58 g/mol |
| Exact Mass | 402.28 |
| IUPAC Name | (1R,3S,7R,8E,11S,12R)-12-[(Z,2S)-5,6-dihydroxy-6-methylhept-3-en-2-yl]-8-(hydroxymethyl)-1,4-dimethyltricyclo[9.3.0.03,7]tetradeca-4,8-dien-6-one |
| SMILES | CC1=CC(=O)[C@H]2/C(CO)=C\C[C@H]3[C@@H]([C@@H](C)/C=C\C(O)C(C)(C)O)CC[C@]3(C)C[C@H]12 |
| InChI | InChI=1S/C25H38O4/c1-15(6-9-22(28)24(3,4)29)18-10-11-25(5)13-19-16(2)12-21(27)23(19)17(14-26)7-8-20(18)25/h6-7,9,12,15,18-20,22-23,26,28-29H,8,10-11,13-14H2,1-5H3/b9-6-,17-7-/t15-,18+,19+,20-,22?,23-,25+/m0/s1 |
| InChIKey | XNUYGVJVLYMPBR-BEJGHCOTSA-N |
| XLogP | 3.82 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.58 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|