C21H30O4 — CID 139587201
(5aR,6R,8aR)-6-[(E,2R,5R)-6-hydroxy-5-(hydroxymethyl)-6-methylhept-3-en-2-yl]-5a-methyl-6,7,8,8a-tetrahydro-5H-cyclopenta[e][1]benzofuran-2-one (PubChem CID 139587201) has the molecular formula C21H30O4 and a molecular weight of 346.47 g/mol. Its IUPAC name is (5aR,6R,8aR)-6-[(E,2R,5R)-6-hydroxy-5-(hydroxymethyl)-6-methylhept-3-en-2-yl]-5a-methyl-6,7,8,8a-tetrahydro-5H-cyclopenta[e][1]benzofuran-2-one.
| Compound Name | (5aR,6R,8aR)-6-[(E,2R,5R)-6-hydroxy-5-(hydroxymethyl)-6-methylhept-3-en-2-yl]-5a-methyl-6,7,8,8a-tetrahydro-5H-cyclopenta[e][1]benzofuran-2-one |
|---|---|
| PubChem CID | 139587201 |
| Molecular Formula | C21H30O4 |
| Molecular Weight | 346.47 g/mol |
| Exact Mass | 346.21 |
| IUPAC Name | (5aR,6R,8aR)-6-[(E,2R,5R)-6-hydroxy-5-(hydroxymethyl)-6-methylhept-3-en-2-yl]-5a-methyl-6,7,8,8a-tetrahydro-5H-cyclopenta[e][1]benzofuran-2-one |
| SMILES | C[C@H](/C=C/[C@H](CO)C(C)(C)O)[C@H]1CC[C@H]2C3=CC(=O)OC3=CC[C@]12C |
| InChI | InChI=1S/C21H30O4/c1-13(5-6-14(12-22)20(2,3)24)16-7-8-17-15-11-19(23)25-18(15)9-10-21(16,17)4/h5-6,9,11,13-14,16-17,22,24H,7-8,10,12H2,1-4H3/b6-5+/t13-,14-,16-,17+,21-/m1/s1 |
| InChIKey | XKQHZDGUKFZJCK-PVZDKWSNSA-N |
| XLogP | 3.36 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.47 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|