C25H37NO5 — CID 53359929
methyl (4R)-4-[(1S,2S,8R,11R,12S,15R,16R)-2,16-dimethyl-6,10,17-trioxo-5-azatetracyclo[9.7.0.02,8.012,16]octadecan-15-yl]pentanoate (PubChem CID 53359929) has the molecular formula C25H37NO5 and a molecular weight of 431.57 g/mol. Its IUPAC name is methyl (4R)-4-[(1S,2S,8R,11R,12S,15R,16R)-2,16-dimethyl-6,10,17-trioxo-5-azatetracyclo[9.7.0.02,8.012,16]octadecan-15-yl]pentanoate.
| Compound Name | methyl (4R)-4-[(1S,2S,8R,11R,12S,15R,16R)-2,16-dimethyl-6,10,17-trioxo-5-azatetracyclo[9.7.0.02,8.012,16]octadecan-15-yl]pentanoate |
|---|---|
| PubChem CID | 53359929 |
| Molecular Formula | C25H37NO5 |
| Molecular Weight | 431.57 g/mol |
| Exact Mass | 431.27 |
| IUPAC Name | methyl (4R)-4-[(1S,2S,8R,11R,12S,15R,16R)-2,16-dimethyl-6,10,17-trioxo-5-azatetracyclo[9.7.0.02,8.012,16]octadecan-15-yl]pentanoate |
| SMILES | COC(=O)CC[C@@H](C)[C@H]1CC[C@H]2[C@@H]3C(=O)C[C@@H]4CC(=O)NCC[C@]4(C)[C@H]3CC(=O)[C@]12C |
| InChI | InChI=1S/C25H37NO5/c1-14(5-8-22(30)31-4)16-6-7-17-23-18(13-20(28)25(16,17)3)24(2)9-10-26-21(29)12-15(24)11-19(23)27/h14-18,23H,5-13H2,1-4H3,(H,26,29)/t14-,15-,16-,17+,18+,23+,24+,25-/m1/s1 |
| InChIKey | QTSOKROIUVVZDS-ABGFBDRTSA-N |
| XLogP | 3.32 |
| TPSA | 89.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.57 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |