C25H40N2O4 — CID 170908034
methyl (4R)-4-[(2S,8R,15R,16R)-2,16-dimethyl-6,18-dioxo-5,17-diazatetracyclo[9.8.0.02,8.012,16]nonadecan-15-yl]pentanoate (PubChem CID 170908034) has the molecular formula C25H40N2O4 and a molecular weight of 432.61 g/mol. Its IUPAC name is methyl (4R)-4-[(2S,8R,15R,16R)-2,16-dimethyl-6,18-dioxo-5,17-diazatetracyclo[9.8.0.02,8.012,16]nonadecan-15-yl]pentanoate.
| Compound Name | methyl (4R)-4-[(2S,8R,15R,16R)-2,16-dimethyl-6,18-dioxo-5,17-diazatetracyclo[9.8.0.02,8.012,16]nonadecan-15-yl]pentanoate |
|---|---|
| PubChem CID | 170908034 |
| Molecular Formula | C25H40N2O4 |
| Molecular Weight | 432.61 g/mol |
| Exact Mass | 432.30 |
| IUPAC Name | methyl (4R)-4-[(2S,8R,15R,16R)-2,16-dimethyl-6,18-dioxo-5,17-diazatetracyclo[9.8.0.02,8.012,16]nonadecan-15-yl]pentanoate |
| SMILES | COC(=O)CC[C@@H](C)[C@H]1CCC2C3CC[C@@H]4CC(=O)NCC[C@]4(C)C3CC(=O)N[C@@]21C |
| InChI | InChI=1S/C25H40N2O4/c1-15(5-10-23(30)31-4)18-8-9-19-17-7-6-16-13-21(28)26-12-11-24(16,2)20(17)14-22(29)27-25(18,19)3/h15-20H,5-14H2,1-4H3,(H,26,28)(H,27,29)/t15-,16-,17?,18-,19?,20?,24+,25-/m1/s1 |
| InChIKey | OUXODJOQSKICDA-MHPOMNQRSA-N |
| XLogP | 3.44 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.61 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |