C25H41NO4 — CID 71579856
methyl (4R)-4-[(1R,2S,5R,6R,10S,11S,14S,16R)-14-hydroxy-6,11-dimethyl-8-oxo-7-azatetracyclo[8.8.0.02,6.011,16]octadecan-5-yl]pentanoate (PubChem CID 71579856) has the molecular formula C25H41NO4 and a molecular weight of 419.61 g/mol. Its IUPAC name is methyl (4R)-4-[(1R,2S,5R,6R,10S,11S,14S,16R)-14-hydroxy-6,11-dimethyl-8-oxo-7-azatetracyclo[8.8.0.02,6.011,16]octadecan-5-yl]pentanoate.
| Compound Name | methyl (4R)-4-[(1R,2S,5R,6R,10S,11S,14S,16R)-14-hydroxy-6,11-dimethyl-8-oxo-7-azatetracyclo[8.8.0.02,6.011,16]octadecan-5-yl]pentanoate |
|---|---|
| PubChem CID | 71579856 |
| Molecular Formula | C25H41NO4 |
| Molecular Weight | 419.61 g/mol |
| Exact Mass | 419.30 |
| IUPAC Name | methyl (4R)-4-[(1R,2S,5R,6R,10S,11S,14S,16R)-14-hydroxy-6,11-dimethyl-8-oxo-7-azatetracyclo[8.8.0.02,6.011,16]octadecan-5-yl]pentanoate |
| SMILES | COC(=O)CC[C@@H](C)[C@H]1CC[C@H]2[C@@H]3CC[C@@H]4C[C@@H](O)CC[C@]4(C)[C@H]3CC(=O)N[C@]12C |
| InChI | InChI=1S/C25H41NO4/c1-15(5-10-23(29)30-4)19-8-9-20-18-7-6-16-13-17(27)11-12-24(16,2)21(18)14-22(28)26-25(19,20)3/h15-21,27H,5-14H2,1-4H3,(H,26,28)/t15-,16-,17+,18+,19-,20+,21+,24+,25-/m1/s1 |
| InChIKey | NHXKTVOEEMDBPA-XHPWGDQZSA-N |
| XLogP | 4.07 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.61 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |