C15H14Br2N4O3 — CID 53359991
(1R,5S,14S,16R,18S,20R)-7,8-dibromo-17-oxa-2,4,6,12-tetrazahexacyclo[10.8.0.01,5.06,10.014,20.016,18]icosa-7,9-diene-3,11-dione (PubChem CID 53359991) has the molecular formula C15H14Br2N4O3 and a molecular weight of 458.11 g/mol. Its IUPAC name is (1R,5S,14S,16R,18S,20R)-7,8-dibromo-17-oxa-2,4,6,12-tetrazahexacyclo[10.8.0.01,5.06,10.014,20.016,18]icosa-7,9-diene-3,11-dione.
| Compound Name | (1R,5S,14S,16R,18S,20R)-7,8-dibromo-17-oxa-2,4,6,12-tetrazahexacyclo[10.8.0.01,5.06,10.014,20.016,18]icosa-7,9-diene-3,11-dione |
|---|---|
| PubChem CID | 53359991 |
| Molecular Formula | C15H14Br2N4O3 |
| Molecular Weight | 458.11 g/mol |
| Exact Mass | 455.94 |
| IUPAC Name | (1R,5S,14S,16R,18S,20R)-7,8-dibromo-17-oxa-2,4,6,12-tetrazahexacyclo[10.8.0.01,5.06,10.014,20.016,18]icosa-7,9-diene-3,11-dione |
| SMILES | O=C1N[C@H]2n3c(cc(Br)c3Br)C(=O)N3C[C@H]4C[C@H]5O[C@H]5C[C@H]4[C@]23N1 |
| InChI | InChI=1S/C15H14Br2N4O3/c16-7-3-8-12(22)20-4-5-1-9-10(24-9)2-6(5)15(20)13(18-14(23)19-15)21(8)11(7)17/h3,5-6,9-10,13H,1-2,4H2,(H2,18,19,23)/t5-,6-,9-,10+,13+,15-/m1/s1 |
| InChIKey | ZTHFIHCIHYUTEI-DWKMIGFJSA-N |
| XLogP | 1.78 |
| TPSA | 78.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.11 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|