C19H27FN2O2S — CID 53361392
N-[2-(4-fluorophenyl)-4-oxo-1,3-thiazolidin-3-yl]decanamide (PubChem CID 53361392) has the molecular formula C19H27FN2O2S and a molecular weight of 366.50 g/mol. Its IUPAC name is N-[2-(4-fluorophenyl)-4-oxo-1,3-thiazolidin-3-yl]decanamide.
| Compound Name | N-[2-(4-fluorophenyl)-4-oxo-1,3-thiazolidin-3-yl]decanamide |
|---|---|
| PubChem CID | 53361392 |
| Molecular Formula | C19H27FN2O2S |
| Molecular Weight | 366.50 g/mol |
| Exact Mass | 366.18 |
| IUPAC Name | N-[2-(4-fluorophenyl)-4-oxo-1,3-thiazolidin-3-yl]decanamide |
| SMILES | CCCCCCCCCC(=O)NN1C(=O)CSC1c1ccc(F)cc1 |
| InChI | InChI=1S/C19H27FN2O2S/c1-2-3-4-5-6-7-8-9-17(23)21-22-18(24)14-25-19(22)15-10-12-16(20)13-11-15/h10-13,19H,2-9,14H2,1H3,(H,21,23) |
| InChIKey | BDPAXIJZZDECPG-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.50 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|