C24H25N3O3 — CID 53364120
2-(prop-2-enoxymethyl)-4-[[4-[3-(prop-2-enoxymethyl)phenyl]pyrimidin-2-yl]amino]phenol (PubChem CID 53364120) has the molecular formula C24H25N3O3 and a molecular weight of 403.48 g/mol. Its IUPAC name is 2-(prop-2-enoxymethyl)-4-[[4-[3-(prop-2-enoxymethyl)phenyl]pyrimidin-2-yl]amino]phenol.
| Compound Name | 2-(prop-2-enoxymethyl)-4-[[4-[3-(prop-2-enoxymethyl)phenyl]pyrimidin-2-yl]amino]phenol |
|---|---|
| PubChem CID | 53364120 |
| Molecular Formula | C24H25N3O3 |
| Molecular Weight | 403.48 g/mol |
| Exact Mass | 403.19 |
| IUPAC Name | 2-(prop-2-enoxymethyl)-4-[[4-[3-(prop-2-enoxymethyl)phenyl]pyrimidin-2-yl]amino]phenol |
| SMILES | C=CCOCc1cccc(-c2ccnc(Nc3ccc(O)c(COCC=C)c3)n2)c1 |
| InChI | InChI=1S/C24H25N3O3/c1-3-12-29-16-18-6-5-7-19(14-18)22-10-11-25-24(27-22)26-21-8-9-23(28)20(15-21)17-30-13-4-2/h3-11,14-15,28H,1-2,12-13,16-17H2,(H,25,26,27) |
| InChIKey | RPAIGTAXOVMWQC-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 76.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.48 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|