C16H17FN2OS — CID 53364726
1-(3-ethylphenyl)-3-(3-fluoro-4-methoxyphenyl)thiourea (PubChem CID 53364726) has the molecular formula C16H17FN2OS and a molecular weight of 304.39 g/mol. Its IUPAC name is 1-(3-ethylphenyl)-3-(3-fluoro-4-methoxyphenyl)thiourea.
| Compound Name | 1-(3-ethylphenyl)-3-(3-fluoro-4-methoxyphenyl)thiourea |
|---|---|
| PubChem CID | 53364726 |
| Molecular Formula | C16H17FN2OS |
| Molecular Weight | 304.39 g/mol |
| Exact Mass | 304.10 |
| IUPAC Name | 1-(3-ethylphenyl)-3-(3-fluoro-4-methoxyphenyl)thiourea |
| SMILES | CCc1cccc(NC(=S)Nc2ccc(OC)c(F)c2)c1 |
| InChI | InChI=1S/C16H17FN2OS/c1-3-11-5-4-6-12(9-11)18-16(21)19-13-7-8-15(20-2)14(17)10-13/h4-10H,3H2,1-2H3,(H2,18,19,21) |
| InChIKey | CMXMUOVGYLEKFT-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 33.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.39 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|