C25H31N3O2S — CID 53366930
2-[5-(4-butoxyphenyl)-2,2-dimethylimidazol-4-yl]sulfanyl-N-(2,5-dimethylphenyl)acetamide (PubChem CID 53366930) has the molecular formula C25H31N3O2S and a molecular weight of 437.61 g/mol. Its IUPAC name is 2-[5-(4-butoxyphenyl)-2,2-dimethylimidazol-4-yl]sulfanyl-N-(2,5-dimethylphenyl)acetamide.
| Compound Name | 2-[5-(4-butoxyphenyl)-2,2-dimethylimidazol-4-yl]sulfanyl-N-(2,5-dimethylphenyl)acetamide |
|---|---|
| PubChem CID | 53366930 |
| Molecular Formula | C25H31N3O2S |
| Molecular Weight | 437.61 g/mol |
| Exact Mass | 437.21 |
| IUPAC Name | 2-[5-(4-butoxyphenyl)-2,2-dimethylimidazol-4-yl]sulfanyl-N-(2,5-dimethylphenyl)acetamide |
| SMILES | CCCCOc1ccc(C2=NC(C)(C)N=C2SCC(=O)Nc2cc(C)ccc2C)cc1 |
| InChI | InChI=1S/C25H31N3O2S/c1-6-7-14-30-20-12-10-19(11-13-20)23-24(28-25(4,5)27-23)31-16-22(29)26-21-15-17(2)8-9-18(21)3/h8-13,15H,6-7,14,16H2,1-5H3,(H,26,29) |
| InChIKey | PHMRUQCEOXWGJO-UHFFFAOYSA-N |
| XLogP | 5.79 |
| TPSA | 63.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.61 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|