C24H28FN3O3S — CID 53366961
2-[5-(4-butoxyphenyl)-2,2-dimethylimidazol-4-yl]sulfanyl-N-(3-fluoro-4-methoxyphenyl)acetamide (PubChem CID 53366961) has the molecular formula C24H28FN3O3S and a molecular weight of 457.57 g/mol. Its IUPAC name is 2-[5-(4-butoxyphenyl)-2,2-dimethylimidazol-4-yl]sulfanyl-N-(3-fluoro-4-methoxyphenyl)acetamide.
| Compound Name | 2-[5-(4-butoxyphenyl)-2,2-dimethylimidazol-4-yl]sulfanyl-N-(3-fluoro-4-methoxyphenyl)acetamide |
|---|---|
| PubChem CID | 53366961 |
| Molecular Formula | C24H28FN3O3S |
| Molecular Weight | 457.57 g/mol |
| Exact Mass | 457.18 |
| IUPAC Name | 2-[5-(4-butoxyphenyl)-2,2-dimethylimidazol-4-yl]sulfanyl-N-(3-fluoro-4-methoxyphenyl)acetamide |
| SMILES | CCCCOc1ccc(C2=NC(C)(C)N=C2SCC(=O)Nc2ccc(OC)c(F)c2)cc1 |
| InChI | InChI=1S/C24H28FN3O3S/c1-5-6-13-31-18-10-7-16(8-11-18)22-23(28-24(2,3)27-22)32-15-21(29)26-17-9-12-20(30-4)19(25)14-17/h7-12,14H,5-6,13,15H2,1-4H3,(H,26,29) |
| InChIKey | LMKHPDJYILLVST-UHFFFAOYSA-N |
| XLogP | 5.32 |
| TPSA | 72.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.57 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|