C23H26BrN3O2S — CID 53366935
N-(3-bromophenyl)-2-[5-(4-butoxyphenyl)-2,2-dimethylimidazol-4-yl]sulfanylacetamide (PubChem CID 53366935) has the molecular formula C23H26BrN3O2S and a molecular weight of 488.45 g/mol. Its IUPAC name is N-(3-bromophenyl)-2-[5-(4-butoxyphenyl)-2,2-dimethylimidazol-4-yl]sulfanylacetamide.
| Compound Name | N-(3-bromophenyl)-2-[5-(4-butoxyphenyl)-2,2-dimethylimidazol-4-yl]sulfanylacetamide |
|---|---|
| PubChem CID | 53366935 |
| Molecular Formula | C23H26BrN3O2S |
| Molecular Weight | 488.45 g/mol |
| Exact Mass | 487.09 |
| IUPAC Name | N-(3-bromophenyl)-2-[5-(4-butoxyphenyl)-2,2-dimethylimidazol-4-yl]sulfanylacetamide |
| SMILES | CCCCOc1ccc(C2=NC(C)(C)N=C2SCC(=O)Nc2cccc(Br)c2)cc1 |
| InChI | InChI=1S/C23H26BrN3O2S/c1-4-5-13-29-19-11-9-16(10-12-19)21-22(27-23(2,3)26-21)30-15-20(28)25-18-8-6-7-17(24)14-18/h6-12,14H,4-5,13,15H2,1-3H3,(H,25,28) |
| InChIKey | ZLHAZDCCZFAYCR-UHFFFAOYSA-N |
| XLogP | 5.94 |
| TPSA | 63.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.45 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|