C16H21N3O3S2 — CID 53367396
4-amino-N-(2,2-dimethoxyethyl)-3-(2,5-dimethylphenyl)-2-sulfanylidene-1,3-thiazole-5-carboxamide (PubChem CID 53367396) has the molecular formula C16H21N3O3S2 and a molecular weight of 367.50 g/mol. Its IUPAC name is 4-amino-N-(2,2-dimethoxyethyl)-3-(2,5-dimethylphenyl)-2-sulfanylidene-1,3-thiazole-5-carboxamide.
| Compound Name | 4-amino-N-(2,2-dimethoxyethyl)-3-(2,5-dimethylphenyl)-2-sulfanylidene-1,3-thiazole-5-carboxamide |
|---|---|
| PubChem CID | 53367396 |
| Molecular Formula | C16H21N3O3S2 |
| Molecular Weight | 367.50 g/mol |
| Exact Mass | 367.10 |
| IUPAC Name | 4-amino-N-(2,2-dimethoxyethyl)-3-(2,5-dimethylphenyl)-2-sulfanylidene-1,3-thiazole-5-carboxamide |
| SMILES | COC(CNC(=O)c1sc(=S)n(-c2cc(C)ccc2C)c1N)OC |
| InChI | InChI=1S/C16H21N3O3S2/c1-9-5-6-10(2)11(7-9)19-14(17)13(24-16(19)23)15(20)18-8-12(21-3)22-4/h5-7,12H,8,17H2,1-4H3,(H,18,20) |
| InChIKey | LAJPXHFIRFJJCL-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.50 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thiaz_ene_B(17)', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|