C18H15ClN6O — CID 53369220
N-[2-(6-chloroindol-1-yl)ethyl]-4-(tetrazol-1-yl)benzamide (PubChem CID 53369220) has the molecular formula C18H15ClN6O and a molecular weight of 366.81 g/mol. Its IUPAC name is N-[2-(6-chloroindol-1-yl)ethyl]-4-(tetrazol-1-yl)benzamide.
| Compound Name | N-[2-(6-chloroindol-1-yl)ethyl]-4-(tetrazol-1-yl)benzamide |
|---|---|
| PubChem CID | 53369220 |
| Molecular Formula | C18H15ClN6O |
| Molecular Weight | 366.81 g/mol |
| Exact Mass | 366.10 |
| IUPAC Name | N-[2-(6-chloroindol-1-yl)ethyl]-4-(tetrazol-1-yl)benzamide |
| SMILES | O=C(NCCn1ccc2ccc(Cl)cc21)c1ccc(-n2cnnn2)cc1 |
| InChI | InChI=1S/C18H15ClN6O/c19-15-4-1-13-7-9-24(17(13)11-15)10-8-20-18(26)14-2-5-16(6-3-14)25-12-21-22-23-25/h1-7,9,11-12H,8,10H2,(H,20,26) |
| InChIKey | FOVMAEYLNRKGPL-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 77.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.81 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |