C14H14N4OS2 — CID 53370657
13-methyl-11-morpholin-4-yl-8-thia-3,5,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),4,10,12-pentaene-6-thione (PubChem CID 53370657) has the molecular formula C14H14N4OS2 and a molecular weight of 318.43 g/mol. Its IUPAC name is 13-methyl-11-morpholin-4-yl-8-thia-3,5,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),4,10,12-pentaene-6-thione.
| Compound Name | 13-methyl-11-morpholin-4-yl-8-thia-3,5,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),4,10,12-pentaene-6-thione |
|---|---|
| PubChem CID | 53370657 |
| Molecular Formula | C14H14N4OS2 |
| Molecular Weight | 318.43 g/mol |
| Exact Mass | 318.06 |
| IUPAC Name | 13-methyl-11-morpholin-4-yl-8-thia-3,5,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),4,10,12-pentaene-6-thione |
| SMILES | Cc1cc(N2CCOCC2)nc2sc3c(=S)nc[nH]c3c12 |
| InChI | InChI=1S/C14H14N4OS2/c1-8-6-9(18-2-4-19-5-3-18)17-14-10(8)11-12(21-14)13(20)16-7-15-11/h6-7H,2-5H2,1H3,(H,15,16,20) |
| InChIKey | KSJOGRYHVQEDSX-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 54.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.43 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|