C16H19N5O2S — CID 53370540
2-[(13-methyl-11-morpholin-4-yl-8-thia-3,5,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaen-6-yl)amino]ethanol (PubChem CID 53370540) has the molecular formula C16H19N5O2S and a molecular weight of 345.43 g/mol. Its IUPAC name is 2-[(13-methyl-11-morpholin-4-yl-8-thia-3,5,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaen-6-yl)amino]ethanol.
| Compound Name | 2-[(13-methyl-11-morpholin-4-yl-8-thia-3,5,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaen-6-yl)amino]ethanol |
|---|---|
| PubChem CID | 53370540 |
| Molecular Formula | C16H19N5O2S |
| Molecular Weight | 345.43 g/mol |
| Exact Mass | 345.13 |
| IUPAC Name | 2-[(13-methyl-11-morpholin-4-yl-8-thia-3,5,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaen-6-yl)amino]ethanol |
| SMILES | Cc1cc(N2CCOCC2)nc2sc3c(NCCO)ncnc3c12 |
| InChI | InChI=1S/C16H19N5O2S/c1-10-8-11(21-3-6-23-7-4-21)20-16-12(10)13-14(24-16)15(17-2-5-22)19-9-18-13/h8-9,22H,2-7H2,1H3,(H,17,18,19) |
| InChIKey | FZFHNCPYFXDCAO-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 83.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.43 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |