C15H16N4O2S — CID 53368738
4-(6-methoxy-13-methyl-8-thia-3,5,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaen-11-yl)morpholine (PubChem CID 53368738) has the molecular formula C15H16N4O2S and a molecular weight of 316.39 g/mol. Its IUPAC name is 4-(6-methoxy-13-methyl-8-thia-3,5,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaen-11-yl)morpholine.
| Compound Name | 4-(6-methoxy-13-methyl-8-thia-3,5,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaen-11-yl)morpholine |
|---|---|
| PubChem CID | 53368738 |
| Molecular Formula | C15H16N4O2S |
| Molecular Weight | 316.39 g/mol |
| Exact Mass | 316.10 |
| IUPAC Name | 4-(6-methoxy-13-methyl-8-thia-3,5,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaen-11-yl)morpholine |
| SMILES | COc1ncnc2c1sc1nc(N3CCOCC3)cc(C)c12 |
| InChI | InChI=1S/C15H16N4O2S/c1-9-7-10(19-3-5-21-6-4-19)18-15-11(9)12-13(22-15)14(20-2)17-8-16-12/h7-8H,3-6H2,1-2H3 |
| InChIKey | YJYHPILEXHKEOF-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 60.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.39 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |