C14H12N4O2S — CID 23559441
6-morpholin-4-yl-8-thia-3,5,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaene-12-carbaldehyde (PubChem CID 23559441) has the molecular formula C14H12N4O2S and a molecular weight of 300.34 g/mol. Its IUPAC name is 6-morpholin-4-yl-8-thia-3,5,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaene-12-carbaldehyde.
| Compound Name | 6-morpholin-4-yl-8-thia-3,5,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaene-12-carbaldehyde |
|---|---|
| PubChem CID | 23559441 |
| Molecular Formula | C14H12N4O2S |
| Molecular Weight | 300.34 g/mol |
| Exact Mass | 300.07 |
| IUPAC Name | 6-morpholin-4-yl-8-thia-3,5,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaene-12-carbaldehyde |
| SMILES | O=Cc1cnc2sc3c(N4CCOCC4)ncnc3c2c1 |
| InChI | InChI=1S/C14H12N4O2S/c19-7-9-5-10-11-12(21-14(10)15-6-9)13(17-8-16-11)18-1-3-20-4-2-18/h5-8H,1-4H2 |
| InChIKey | GELVEUKRTBYFKA-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 68.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.34 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|