C15H17N5S — CID 110433838
6-(4-ethylpiperazin-1-yl)-8-thia-3,5,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaene (PubChem CID 110433838) has the molecular formula C15H17N5S and a molecular weight of 299.40 g/mol. Its IUPAC name is 6-(4-ethylpiperazin-1-yl)-8-thia-3,5,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaene.
| Compound Name | 6-(4-ethylpiperazin-1-yl)-8-thia-3,5,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaene |
|---|---|
| PubChem CID | 110433838 |
| Molecular Formula | C15H17N5S |
| Molecular Weight | 299.40 g/mol |
| Exact Mass | 299.12 |
| IUPAC Name | 6-(4-ethylpiperazin-1-yl)-8-thia-3,5,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaene |
| SMILES | CCN1CCN(c2ncnc3c2sc2ncccc23)CC1 |
| InChI | InChI=1S/C15H17N5S/c1-2-19-6-8-20(9-7-19)14-13-12(17-10-18-14)11-4-3-5-16-15(11)21-13/h3-5,10H,2,6-9H2,1H3 |
| InChIKey | WBRBOSDEHHCNKV-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 45.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.40 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |