C26H28N6OS — CID 27372576
(4-benzylpiperazin-1-yl)-[1-(8-thia-3,5,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaen-6-yl)piperidin-4-yl]methanone (PubChem CID 27372576) has the molecular formula C26H28N6OS and a molecular weight of 472.62 g/mol. Its IUPAC name is (4-benzylpiperazin-1-yl)-[1-(8-thia-3,5,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaen-6-yl)piperidin-4-yl]methanone.
| Compound Name | (4-benzylpiperazin-1-yl)-[1-(8-thia-3,5,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaen-6-yl)piperidin-4-yl]methanone |
|---|---|
| PubChem CID | 27372576 |
| Molecular Formula | C26H28N6OS |
| Molecular Weight | 472.62 g/mol |
| Exact Mass | 472.20 |
| IUPAC Name | (4-benzylpiperazin-1-yl)-[1-(8-thia-3,5,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaen-6-yl)piperidin-4-yl]methanone |
| SMILES | O=C(C1CCN(c2ncnc3c2sc2ncccc23)CC1)N1CCN(Cc2ccccc2)CC1 |
| InChI | InChI=1S/C26H28N6OS/c33-26(32-15-13-30(14-16-32)17-19-5-2-1-3-6-19)20-8-11-31(12-9-20)24-23-22(28-18-29-24)21-7-4-10-27-25(21)34-23/h1-7,10,18,20H,8-9,11-17H2 |
| InChIKey | KFBIVINNHAPDTC-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 65.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.62 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |