C22H20ClN5OS — CID 27372557
N-[(2-chlorophenyl)methyl]-1-(8-thia-3,5,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaen-6-yl)piperidine-4-carboxamide (PubChem CID 27372557) has the molecular formula C22H20ClN5OS and a molecular weight of 437.96 g/mol. Its IUPAC name is N-[(2-chlorophenyl)methyl]-1-(8-thia-3,5,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaen-6-yl)piperidine-4-carboxamide.
| Compound Name | N-[(2-chlorophenyl)methyl]-1-(8-thia-3,5,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaen-6-yl)piperidine-4-carboxamide |
|---|---|
| PubChem CID | 27372557 |
| Molecular Formula | C22H20ClN5OS |
| Molecular Weight | 437.96 g/mol |
| Exact Mass | 437.11 |
| IUPAC Name | N-[(2-chlorophenyl)methyl]-1-(8-thia-3,5,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaen-6-yl)piperidine-4-carboxamide |
| SMILES | O=C(NCc1ccccc1Cl)C1CCN(c2ncnc3c2sc2ncccc23)CC1 |
| InChI | InChI=1S/C22H20ClN5OS/c23-17-6-2-1-4-15(17)12-25-21(29)14-7-10-28(11-8-14)20-19-18(26-13-27-20)16-5-3-9-24-22(16)30-19/h1-6,9,13-14H,7-8,10-12H2,(H,25,29) |
| InChIKey | GMKDTYGBCNSSKJ-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 71.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.96 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |