C24H25N7OS — CID 27372240
(4-pyridin-2-ylpiperazin-1-yl)-[1-(8-thia-3,5,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaen-6-yl)piperidin-4-yl]methanone (PubChem CID 27372240) has the molecular formula C24H25N7OS and a molecular weight of 459.58 g/mol. Its IUPAC name is (4-pyridin-2-ylpiperazin-1-yl)-[1-(8-thia-3,5,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaen-6-yl)piperidin-4-yl]methanone.
| Compound Name | (4-pyridin-2-ylpiperazin-1-yl)-[1-(8-thia-3,5,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaen-6-yl)piperidin-4-yl]methanone |
|---|---|
| PubChem CID | 27372240 |
| Molecular Formula | C24H25N7OS |
| Molecular Weight | 459.58 g/mol |
| Exact Mass | 459.18 |
| IUPAC Name | (4-pyridin-2-ylpiperazin-1-yl)-[1-(8-thia-3,5,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaen-6-yl)piperidin-4-yl]methanone |
| SMILES | O=C(C1CCN(c2ncnc3c2sc2ncccc23)CC1)N1CCN(c2ccccn2)CC1 |
| InChI | InChI=1S/C24H25N7OS/c32-24(31-14-12-29(13-15-31)19-5-1-2-8-25-19)17-6-10-30(11-7-17)22-21-20(27-16-28-22)18-4-3-9-26-23(18)33-21/h1-5,8-9,16-17H,6-7,10-15H2 |
| InChIKey | PWZJKDXWEXQNFO-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 78.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.58 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |