C20H31N5O2 — CID 53370981
N-[1-(cyclopentylamino)-3-methyl-1-oxobutan-2-yl]-4-pyridin-2-ylpiperazine-1-carboxamide (PubChem CID 53370981) has the molecular formula C20H31N5O2 and a molecular weight of 373.50 g/mol. Its IUPAC name is N-[1-(cyclopentylamino)-3-methyl-1-oxobutan-2-yl]-4-pyridin-2-ylpiperazine-1-carboxamide.
| Compound Name | N-[1-(cyclopentylamino)-3-methyl-1-oxobutan-2-yl]-4-pyridin-2-ylpiperazine-1-carboxamide |
|---|---|
| PubChem CID | 53370981 |
| Molecular Formula | C20H31N5O2 |
| Molecular Weight | 373.50 g/mol |
| Exact Mass | 373.25 |
| IUPAC Name | N-[1-(cyclopentylamino)-3-methyl-1-oxobutan-2-yl]-4-pyridin-2-ylpiperazine-1-carboxamide |
| SMILES | CC(C)C(NC(=O)N1CCN(c2ccccn2)CC1)C(=O)NC1CCCC1 |
| InChI | InChI=1S/C20H31N5O2/c1-15(2)18(19(26)22-16-7-3-4-8-16)23-20(27)25-13-11-24(12-14-25)17-9-5-6-10-21-17/h5-6,9-10,15-16,18H,3-4,7-8,11-14H2,1-2H3,(H,22,26)(H,23,27) |
| InChIKey | WSKAUJLOZRANTE-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 77.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.50 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |