C19H20ClN3O — CID 53373021
1-(8-chloro-2,3,4,5-tetrahydro-1H-pyrido[4,3-b]indol-6-yl)-2-pyridin-3-ylpropan-2-ol (PubChem CID 53373021) has the molecular formula C19H20ClN3O and a molecular weight of 341.84 g/mol. Its IUPAC name is 1-(8-chloro-2,3,4,5-tetrahydro-1H-pyrido[4,3-b]indol-6-yl)-2-pyridin-3-ylpropan-2-ol.
| Compound Name | 1-(8-chloro-2,3,4,5-tetrahydro-1H-pyrido[4,3-b]indol-6-yl)-2-pyridin-3-ylpropan-2-ol |
|---|---|
| PubChem CID | 53373021 |
| Molecular Formula | C19H20ClN3O |
| Molecular Weight | 341.84 g/mol |
| Exact Mass | 341.13 |
| IUPAC Name | 1-(8-chloro-2,3,4,5-tetrahydro-1H-pyrido[4,3-b]indol-6-yl)-2-pyridin-3-ylpropan-2-ol |
| SMILES | CC(O)(Cc1cc(Cl)cc2c3c([nH]c12)CCNC3)c1cccnc1 |
| InChI | InChI=1S/C19H20ClN3O/c1-19(24,13-3-2-5-21-10-13)9-12-7-14(20)8-15-16-11-22-6-4-17(16)23-18(12)15/h2-3,5,7-8,10,22-24H,4,6,9,11H2,1H3 |
| InChIKey | QWPMIACAFOAZCG-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 60.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.84 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|