C11H9F11O2 — CID 53374908
propyl 2-(difluoromethylidene)-5,5,5-trifluoro-4,4-bis(trifluoromethyl)pentanoate (PubChem CID 53374908) has the molecular formula C11H9F11O2 and a molecular weight of 382.17 g/mol. Its IUPAC name is propyl 2-(difluoromethylidene)-5,5,5-trifluoro-4,4-bis(trifluoromethyl)pentanoate.
| Compound Name | propyl 2-(difluoromethylidene)-5,5,5-trifluoro-4,4-bis(trifluoromethyl)pentanoate |
|---|---|
| PubChem CID | 53374908 |
| Molecular Formula | C11H9F11O2 |
| Molecular Weight | 382.17 g/mol |
| Exact Mass | 382.04 |
| IUPAC Name | propyl 2-(difluoromethylidene)-5,5,5-trifluoro-4,4-bis(trifluoromethyl)pentanoate |
| SMILES | CCCOC(=O)C(CC(C(F)(F)F)(C(F)(F)F)C(F)(F)F)=C(F)F |
| InChI | InChI=1S/C11H9F11O2/c1-2-3-24-7(23)5(6(12)13)4-8(9(14,15)16,10(17,18)19)11(20,21)22/h2-4H2,1H3 |
| InChIKey | UPAVRIHRBJCBIJ-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.17 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|