C25H25NO13 — CID 53374992
[3-(4-hydroxyphenyl)-4-oxo-8-[(2S,3R,4R,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]chromen-7-yl] 2-methyl-2-nitrooxypropanoate (PubChem CID 53374992) has the molecular formula C25H25NO13 and a molecular weight of 547.47 g/mol. Its IUPAC name is [3-(4-hydroxyphenyl)-4-oxo-8-[(2S,3R,4R,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]chromen-7-yl] 2-methyl-2-nitrooxypropanoate.
| Compound Name | [3-(4-hydroxyphenyl)-4-oxo-8-[(2S,3R,4R,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]chromen-7-yl] 2-methyl-2-nitrooxypropanoate |
|---|---|
| PubChem CID | 53374992 |
| Molecular Formula | C25H25NO13 |
| Molecular Weight | 547.47 g/mol |
| Exact Mass | 547.13 |
| IUPAC Name | [3-(4-hydroxyphenyl)-4-oxo-8-[(2S,3R,4R,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]chromen-7-yl] 2-methyl-2-nitrooxypropanoate |
| SMILES | CC(C)(O[N+](=O)[O-])C(=O)Oc1ccc2c(=O)c(-c3ccc(O)cc3)coc2c1[C@@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C25H25NO13/c1-25(2,39-26(34)35)24(33)38-15-8-7-13-18(29)14(11-3-5-12(28)6-4-11)10-36-22(13)17(15)23-21(32)20(31)19(30)16(9-27)37-23/h3-8,10,16,19-21,23,27-28,30-32H,9H2,1-2H3/t16-,19-,20+,21-,23+/m1/s1 |
| InChIKey | MZUYNTDZDVQANA-CKSGFJDPSA-N |
| XLogP | 0.57 |
| TPSA | 219.26 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.47 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|