C25H28O9 — CID 101270822
7-ethoxy-3-(4-ethoxyphenyl)-8-[(2S,3R,4R,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]chromen-4-one (PubChem CID 101270822) has the molecular formula C25H28O9 and a molecular weight of 472.49 g/mol. Its IUPAC name is 7-ethoxy-3-(4-ethoxyphenyl)-8-[(2S,3R,4R,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]chromen-4-one.
| Compound Name | 7-ethoxy-3-(4-ethoxyphenyl)-8-[(2S,3R,4R,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]chromen-4-one |
|---|---|
| PubChem CID | 101270822 |
| Molecular Formula | C25H28O9 |
| Molecular Weight | 472.49 g/mol |
| Exact Mass | 472.17 |
| IUPAC Name | 7-ethoxy-3-(4-ethoxyphenyl)-8-[(2S,3R,4R,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]chromen-4-one |
| SMILES | CCOc1ccc(-c2coc3c([C@@H]4O[C@H](CO)[C@@H](O)[C@H](O)[C@H]4O)c(OCC)ccc3c2=O)cc1 |
| InChI | InChI=1S/C25H28O9/c1-3-31-14-7-5-13(6-8-14)16-12-33-24-15(20(16)27)9-10-17(32-4-2)19(24)25-23(30)22(29)21(28)18(11-26)34-25/h5-10,12,18,21-23,25-26,28-30H,3-4,11H2,1-2H3/t18-,21-,22+,23-,25+/m1/s1 |
| InChIKey | PVHPLKOBHBKMAB-FLYQRFDZSA-N |
| XLogP | 1.77 |
| TPSA | 138.82 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.49 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |